Dabigatran Impurity F is a chemical compound used as a pharmaceutical impurity reference standard, specifically for quality control in the manufacturing of dabigatran-related products. It is an ester derivative featuring a benzimidazole core and a pyridine ring, characterized by moderate polarity and aromatic functionality.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dabigatran iMpurity F 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-Propylsulfamide sodium salt
chemical research reagent
4-Fluorobenzylmagnesium chloride
Grignard reagent for organic synthesis
Rac-(1R,2S)-2-(3-fluorophenyl)cyclopropan-1-amine hydrochloride
research compound
2-Bromo-4-(tert-butyl-d9)-pyridine
deuterated research compound
ethyl 3-[(1-methyl-2-oxo-3H-benzimidazole-5-carbonyl)-pyridin-2-ylamino]propanoate
XGBDRKLLXAESOC-UHFFFAOYSA-N
CCOC(=O)CCN(C1=CC=CC=N1)C(=O)C2=CC3=C(C=C2)N(C(=O)N3)C
Dabigatran iMpurity F 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.