This compound is a piperidine derivative with two hydroxyl groups, commonly used as an intermediate in the synthesis of pharmaceutical compounds. Its structure features a tert-butyl carbamate protecting group, making it valuable in multi-step organic synthesis for building complex molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1638760-09-4
Tert-butyl (3R,4R)-4-amino-3-hydroxypiperidine-1-carboxylate
Pharmaceutical intermediate for piperidine derivatives
Tert-butyl (3S,4S)-4-amino-3-hydroxypiperidine-1-carboxylate
research compound
2'-O-MOE-5-Methyl-Uridine Phosphoramidite
phosphoramidite for oligonucleotide synthesis
Mc-Val-Cit-PAB-Cl
Antibody-drug conjugate linker intermediate
2-((2,2-Diphenylvinyl)oxy)-4,6-dimethylpyrimidine
pharmaceutical intermediate
MC-Val-Ala-PAB-PNP
antibody-drug conjugate linker reagent
Tert-Butyl 3,4-dihydroxypiperidine-1-carboxylate
Pharmaceutical intermediate
tert-butyl (3S,4S)-3,4-dihydroxypiperidine-1-carboxylate
RIZGRNBWPJMDKU-YUMQZZPRSA-N
CC(C)(C)OC(=O)N1CC[C@@H]([C@H](C1)O)O
—