This compound is a protected uridine phosphoramidite derivative used as a building block in the solid-phase synthesis of oligonucleotides. Its structure incorporates a 2'-O-(2-methoxyethyl) modification, a 5'-O-dimethoxytrityl protecting group, and a 3'-O-(diisopropylamino-2-cyanoethoxyphosphanyl) group, making it suitable for automated RNA synthesis in research and pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 163759-97-5
Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-propyl-, 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite] (9CI)
RNA synthesis building block
Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-methyl-, 3'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite]
RNA synthesis phosphoramidite building block
2'-propargyl U amidite
RNA synthesis phosphoramidite building block
2'-O-Hexadecyl-U-CE-Phosphoramidite
nucleoside phosphoramidite for oligonucleotide synthesis
(R)-1-Boc-3-methylpiperazine
pharmaceutical intermediate
(S)-2,4,5-Trifluoro-N-(1,1,1-trifluoropropan-2-yl)benzamide
Pharmaceutical intermediate
2-Ethoxy-1,3-benzodioxole-5-carboxaldehyde
pharmaceutical intermediate
(S)-N-Benzyl-1-(1-naphthyl)ethylamine hydrochloride
pharmaceutical intermediate
3-[[(2R,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,4-dioxopyrimidin-1-yl)-4-(2-methoxyethoxy)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile
ZLOKLUONKGURQI-UAQIPLLRSA-N
CC(C)N(C(C)C)P(OCCC#N)O[C@@H]1[C@H](O[C@H]([C@@H]1OCCOC)N2C=CC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC