Tetrabutylthiuram disulfide is an industrial chemical primarily used as an accelerator in the vulcanization of elastomers. Its structure contains multiple alkyl chains and amine groups, contributing to its role in rubber processing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1634-02-2
Tert-Butyl methyl ether
Gasoline octane booster and fuel additive
Magnesium 3-hydroxybutyrate
magnesium salt of 3-hydroxybutyric acid
2-(Propylamino)ethanol
chemical intermediate for amine synthesis
Methyl perfluoroisobutyl ether
Cleaning solvent and specialty fluid
dibutylcarbamothioylsulfanyl N,N-dibutylcarbamodithioate
PGAXJQVAHDTGBB-UHFFFAOYSA-N
CCCCN(CCCC)C(=S)SSC(=S)N(CCCC)CCCC