This compound is a pharmaceutical intermediate featuring a complex structure with multiple stereocenters, containing an alcohol, aromatic rings, ether groups, and a heterocycle. Its high molecular weight and lipophilicity, along with significant hydrogen bond donor and acceptor capacity, indicate a role in the synthesis of specialized organic molecules for pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 162849-95-8
1-((3R,5r,8r,9r,10s,13s,14s,17s)-3-hydroxy-3,13-dimethylhexadecahydro-1h-cyclopenta[a]phenanthren-17-yl)ethanone
pharmaceutical intermediate
(alphaR,2R)-3,4-Dihydro-5-[(4-nitrophenyl)methyl]-alpha-phenyl-2H-pyrrole-2-methanol
pharmaceutical intermediate
Tert-butyl (R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-7(8H)-carboxylate
Pharmaceutical intermediate
4-(Piperidin-4-yl)benzonitrile--hydrogen chloride (1/1)
pharmaceutical intermediate
1,3-Thiazol-5-ylmethyl N-[(1S,2S,4S)-4-amino-1-benzyl-2-hydroxy-5-phenylpentyl]carbamate
pharmaceutical intermediate for protease inhibitors
tert-butyl N-[(2S,4S,5S)-4-hydroxy-1,6-diphenyl-5-(1,3-thiazol-5-ylmethoxycarbonylamino)hexan-2-yl]carbamate
NURNDOWJCSUXHT-HVCNVCAESA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C[C@@H]([C@H](CC2=CC=CC=C2)NC(=O)OCC3=CN=CS3)O