This compound is a research reagent with a complex molecular structure featuring an aromatic ring, amide, and ester groups. Its high flexibility and lipophilicity make it suitable for laboratory studies involving conformationally mobile molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4,4'-(Cyclopenta-2,4-dien-1-ylidenemethylene)bis(methylbenzene)
Research compound for organometallic chemistry
5-Bromo-2-thiopheneboronic Acid (contains varying amounts of Anhydride)
boronic acid cross-coupling reagent
5-Chlorothiophene-2-boronic acid
boronic acid reagent for synthesis
B-1-dibenzofuranylBoronic acid
Boronic acid for chemical synthesis
diethyl 2-acetamido-2-[2-(4-octylphenyl)ethyl]propanedioate
RYOKCHIAMHPMLV-UHFFFAOYSA-N
CCCCCCCCC1=CC=C(C=C1)CCC(C(=O)OCC)(C(=O)OCC)NC(=O)C
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.