This compound is a chiral phosphine ligand employed in asymmetric catalysis. It is structurally characterized as an organometallic complex containing iron and multiple cyclohexyl-substituted phosphine groups, typically supplied as a research reagent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
6-(Benzyloxy)-1H-indole
research compound
Oxo(~15~N)amino
Isotopically labeled nitrogen monoxide
5,6,7-Trimethoxy-2-phenylquinolin-4(1H)-one
research compound
4-(tert-Butyldimethylsilyloxy)phenylboronic Acid (contains varying amounts of Anhydride)
research reagent
LVJMXQBMWBNENE-WLOLSGMKSA-N
C[C@@H]([C]1C=CC=C1P(C2CCCCC2)C3CCCCC3)P(C4CCCCC4)C5CCCCC5.C1=C[CH]C=C1.[Fe]
—
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.