20beta-Dihydroprednisolone is a glucocorticoid compound that serves as a metabolite of prednisolone, characterized by the reduction of the 20-oxo group to a beta-hydroxy group. It is recognized as a human and mammalian metabolite, with structural features of multiple hydroxy and oxo groups on a steroid backbone.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(11beta,20R)-11,17,20,21-Tetrahydroxypregna-1,4-dien-3-one 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(8S,9S,10R,11S,13S,14S,17R)-17-[(1R)-1,2-dihydroxyethyl]-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one
LCOVYWIXMAJCDS-LCGKLAOVSA-N
C[C@]12C[C@@H]([C@H]3[C@H]([C@@H]1CC[C@@]2([C@@H](CO)O)O)CCC4=CC(=O)C=C[C@]34C)O
(11beta,20R)-11,17,20,21-Tetrahydroxypregna-1,4-dien-3-one 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.