20beta-Dihydroprednisolone is a glucocorticoid compound that serves as a metabolite of prednisolone, characterized by the reduction of the 20-oxo group to a beta-hydroxy group. It is recognized as a human and mammalian metabolite, with structural features of multiple hydroxy and oxo groups on a steroid backbone.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 15847-24-2
(8S,9S,10R,11S,13S,14S,17R)-17-[(1R)-1,2-dihydroxyethyl]-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one
LCOVYWIXMAJCDS-LCGKLAOVSA-N
C[C@]12C[C@@H]([C@H]3[C@H]([C@@H]1CC[C@@]2([C@@H](CO)O)O)CCC4=CC(=O)C=C[C@]34C)O