1-Methyladenosine is a methylated nucleoside derived from adenosine, where a methyl group is attached to the nitrogen at position 1 of the adenine base. It is a naturally occurring human metabolite and is commonly used as a research compound in biochemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 15763-06-1
Adenosine-(1)N N1-Oxide
research compound
3,4-Difluoro-2-methylbenzoic acid
research compound
Progesterone-2,2,4,6,6,17alpha,21,21,21-d9
deuterated internal standard for mass spectrometry
Mal-C6-|A-Amanitin
Research compound for targeted delivery
(2,2'-Bipyridyl)bis[2-(4-fluorophenyl)pyridine]iridium(III) hexafluorophosphate
organometallic research compound
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-imino-1-methylpurin-9-yl)oxolane-3,4-diol
GFYLSDSUCHVORB-IOSLPCCCSA-N
CN1C=NC2=C(C1=N)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O