This compound is a pharmaceutical intermediate specifically used in the synthesis of eribulin, a complex macrocyclic ether known for its anticancer activity. It features a tetrahydrofuran ring with an attached iodinated alkene side chain and a pivalate ester group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 157322-47-9
Eribulin mesylate intermediate
Eribulin mesylate synthetic intermediate
1-BOC-3-[(DIMETHYLAMINO)METHYLENE]-4-OXOPIPERIDINE
Pharmaceutical intermediate
2'-dG(iBu)-2'-phosphoramidite
Phosphoramidite reagent for oligonucleotide synthesis
5-Chlorovaleryl chloride
Pharmaceutical intermediate
3-((2S,5S)-5-(3-hydroxypropyl)-4-methylenetetrahydrofuran-2-yl)propyl pivalate
pharmaceutical intermediate
3-((2S,5S)-5-((3R,5R)-5-Methyl-3-((methylsulfonyl)oxy)-6-(((trifluoromethyl)sulfonyl)oxy)hept-6-en-1-yl)-4-methylenetetrahydrofuran-2-yl)propyl pivalate
pharmaceutical intermediate
3-[5-(3-hydroxy-6-iodo-5-methylhept-6-enyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate
BATPHVGPKRJKIK-UHFFFAOYSA-N
CC(CC(CCC1C(=C)CC(O1)CCCOC(=O)C(C)(C)C)O)C(=C)I