This compound is a highly substituted octahydrocorrin derivative containing three nitrophenyl groups, characterized by a complex polycyclic structure with multiple stereocenters and a high molecular weight. Its structural features include multiple aromatic rings and heterocycles, and the presence of both donor and acceptor groups suggests potential electronic or optical properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
8,14-dimethyl-5,10,15-tris(4-nitrophenyl)-1,2,7,8,13,21,22,23-octahydrocorrin
ZBGTYBGGNQXSDZ-UHFFFAOYSA-N
CC1CC2=C(C3=CCC(N3)C4=NC(=C(C5(CC=C(N5)C(=C1N2)C6=CC=C(C=C6)[N+](=O)[O-])C)C7=CC=C(C=C7)[N+](=O)[O-])C=C4)C8=CC=C(C=C8)[N+](=O)[O-]
—
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.