Heptanoic-7,7,7-d3 acid is a deuterium-labeled analytical reference standard, specifically the This compound isotopologue. It is primarily used in research and laboratory settings as a stable isotope internal standard for quantitative analysis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 156779-04-3
Heptadecanoic acid-d3
deuterated fatty acid reference standard
Tetradecanoic-14,14,14-d3 acid
isotopically labeled fatty acid standard
Decanoic-10,10,10-d3 acid
deuterated fatty acid research standard
Nonanoic acid-d3
deuterated fatty acid reference standard
Sodium borodeuteride
deuterated reducing agent
1,8-NAPHTHYRIDINE, 2-METHYL-
chemical research compound
4,4-dimethyl-2-oxotetrahydrofuran-3-yl methacrylate
research compound
(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate
Fmoc-protected aminoacetaldehyde reagent
7,7,7-trideuterioheptanoic acid
MNWFXJYAOYHMED-FIBGUPNXSA-N
[2H]C([2H])([2H])CCCCCC(=O)O