Sodium methallylsulfonate is an industrial chemical primarily used as a surfactant intermediate. It serves as a key building block in the production of various surfactants and surface-active agents.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1561-92-8
TRIMETHYLOLPROPANE TRIACRYLATE
Crosslinking agent for coatings and adhesives
3-Methyl-3-buten-1-yl 2-methyl-2-propenoate
Methacrylate monomer for polymer synthesis
Sodium percarbonate
bleaching agent in laundry and cleaning products
2-Ethylhexyl diphenyl phosphite
Plastic additive
sodium 2-methylprop-2-ene-1-sulfonate
SZHIIIPPJJXYRY-UHFFFAOYSA-M
CC(=C)CS(=O)(=O)[O-].[Na+]