[(2-Aminoethoxy)methyl]tributylstannane is an organotin compound used as a synthetic intermediate in research laboratories. Its structure features a stannane center with a 2-aminoethoxy methyl group, making it valuable for organotin chemistry and specialty synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1557288-04-6
1H-Indazol-5-ol
research compound
(5S)-5-Methyl-2-Pyrrolidinone
research compound
2-(3,4-Difluoro-2-methoxyphenyl)acetic acid
research compound
(3AS,4S,7R,7AS)-6-BENZYL-2,2-DIMETHYLTETRAHYDRO-4H-4,7-METHANO[1,3]DIOXOLO[4,5-D][1,2]OXAZINE
Reference standard for ticagrelor impurity
2-(tributylstannylmethoxy)ethanamine
YFZRXKFYLGAQOC-UHFFFAOYSA-N
CCCC[Sn](CCCC)(CCCC)COCCN