Diethylhexyl Butamido Triazone is a chemical compound used as a UV absorber in sunscreen formulations. It is characterized by a complex structure containing multiple aromatic rings and functional groups that contribute to its ultraviolet light absorption properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 154702-15-5
Ethylhexyl triazone
UVB sunscreen absorber
1-Benzylquinolinium chloride
Quaternary ammonium compound
Methyl 5-((2,4-difluorobenzyl)carbamoyl)-1-(2,2-dimethoxyethyl)-3-methoxy-4-oxo-1,4-dihydropyridine-2-carboxylate
research compound
Palmitoyl hexapeptide-12
cosmetic ingredient
Tetrabutylammonium hydrogencarbonate
phase transfer catalyst
2-ethylhexyl 4-[[4-[4-(tert-butylcarbamoyl)anilino]-6-[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate
OSCJHTSDLYVCQC-UHFFFAOYSA-N
CCCCC(CC)COC(=O)C1=CC=C(C=C1)NC2=NC(=NC(=N2)NC3=CC=C(C=C3)C(=O)NC(C)(C)C)NC4=CC=C(C=C4)C(=O)OCC(CC)CCCC