This compound is a pharmaceutical intermediate used in the synthesis of sulfonamide derivatives. It features a complex heterocyclic structure with multiple functional groups, including an alcohol and an aromatic ring, contributing to its polar and ring-containing character.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 154127-42-1
3-Acetyl-2-(aminosulfonyl)-5-chlorothiophene
Pharmaceutical intermediate for sulfonamide synthesis
2-chloropyridine-3-sulfonyl Chloride
Pharmaceutical intermediate for sulfonamide synthesis
Benzyl 4-(chlorosulfonyl)piperidine-1-carboxylate
Pharmaceutical intermediate for sulfonamide synthesis
Methyl 2-methoxy-5-sulfamoylbenzoate
Pharmaceutical intermediate for sulfonamide synthesis
3,5-Difluoro-4-iodoaniline
pharmaceutical intermediate
2-Isopropyl-4-(N-methyl)amino-methyl thiazole
Pharmaceutical intermediate
3-Keto-5alpha-abiraterone
Abiraterone acetate impurity standard
[(8R,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate
abiraterone acetate intermediate
(4S)-4-hydroxy-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide
UHIWBQIWXWWDKT-MRVPVSSYSA-N
COCCCN1C[C@H](C2=C(S1(=O)=O)SC(=C2)S(=O)(=O)N)O