Diclofenac Methyl Ester is a chemical compound that serves as a pharmaceutical intermediate, primarily used in the manufacturing of related active pharmaceutical ingredients. It features an ester functional group and aromatic rings, contributing to its role in synthetic chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 15307-78-5
Aceclofenac Methyl Ester
Pharmaceutical intermediate for aceclofenac synthesis
Diclofenac Ethyl Ester
active pharmaceutical ingredient
2,6-Dichloro-N-phenylaniline
Pharmaceutical intermediate
Tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate
Boc-protected amine PEG linker for synthesis
3((Dimethylamino)methyl)-1,2,3,9-tetrahydro-9-methyl-4H-carbazol-4-one
pharmaceutical intermediate
1,2-O-(1-methylethylidene)-4-C-[(phenylmethoxy)methyl]-3-O-(phenylmethyl)-L-Lyxofuranose
Pharmaceutical intermediate for nucleoside synthesis
methyl 2-[2-(2,6-dichloroanilino)phenyl]acetate
VETACGBDFVVKGZ-UHFFFAOYSA-N
COC(=O)CC1=CC=CC=C1NC2=C(C=CC=C2Cl)Cl