Ginkgolide B is a naturally occurring diterpenoid lactone found in Ginkgo biloba, characterized by a complex polycyclic structure with multiple ether and ester groups. It is primarily recognized as a research compound for its role as a PAF-receptor antagonist.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 15291-77-7
Flavoxate
antispasmodic pharmaceutical ingredient
Diclofenac Ethyl Ester
active pharmaceutical ingredient
Diclofenac sodium
active pharmaceutical ingredient
Diclofenac potassium
active pharmaceutical ingredient
Ginkgolide A
research compound
Ginkgolide C
n.a
(1R,3R,6R,7S,8S,10R,11R,12S,13S,16S,17R)-8-tert-butyl-6,12,17-trihydroxy-16-methyl-2,4,14,19-tetraoxahexacyclo[8.7.2.01,11.03,7.07,11.013,17]nonadecane-5,15,18-trione
SQOJOAFXDQDRGF-ZMVGXLHTSA-N
C[C@@H]1C(=O)O[C@@H]2[C@]1([C@@]34C(=O)O[C@H]5[C@]3([C@@H]2O)[C@@]6([C@@H](C5)C(C)(C)C)[C@H](C(=O)O[C@H]6O4)O)O