4-Hydroxybenzoic-2,3,5,6-d4 acid is a deuterated form of 4-hydroxybenzoic acid where all four aromatic hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in analytical chemistry to improve the accuracy of quantitative measurements.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 152404-47-2
Acenaphthylene D8
deuterated internal standard for analytical chemistry
Triruthenium dodecacarbonyl
organometallic research reagent
5-Bromo-6-methoxy-1H-indazole
research compound
Bis-PEG6-NHS ester
bifunctional crosslinking reagent
5-bromo-2-methoxy-3-nitropyridine
research compound
Potassium 4-hydroxybenzoate
preservative in cosmetics and food
4-hydroxybenzoic acid
intermediate for food preservatives
2,3,5,6-tetradeuterio-4-hydroxybenzoic acid
FJKROLUGYXJWQN-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])O)[2H]