Sodium dibunate is a chemical compound used as a pharmaceutical raw material. It is the sodium salt form of dibunate, which is known as a cough suppressant.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 14992-59-7
(4S,4aS,5aR,12aS)-9-Amino-4,7-bis(dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide hydrochloride
active pharmaceutical ingredient
(S)-adrenaline
active pharmaceutical ingredient
Rimantadine hydrochloride
active pharmaceutical ingredient
Prasugrel
platelet aggregation inhibitor
sodium 2,6-ditert-butylnaphthalene-1-sulfonate
XYEXKDCAGSHWSD-UHFFFAOYSA-M
CC(C)(C)C1=CC2=C(C=C1)C(=C(C=C2)C(C)(C)C)S(=O)(=O)[O-].[Na+]