(E)-Fenpyroximate (free acid) is an agrochemical compound that serves as a metabolite of the acaricide fenpyroximate. It is characterized by a structure containing aromatic rings, an ether linkage, and a carboxylic acid group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(E)-Fenpyroximate (free acid) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Fenpyroximate
Acaricide and insecticide
Butanoic acid, 2-amino-, (2S)-
herbicide precursor
Bifenazate
Selective miticide for mite control
Nitenpyram
crop pesticide
Calcium ammonium nitrate
Soil amendment fertilizer
4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid
ZGSVZVKVXOZKSG-CIAFOILYSA-N
CC1=NN(C(=C1/C=N/OCC2=CC=C(C=C2)C(=O)O)OC3=CC=CC=C3)C
(E)-Fenpyroximate (free acid) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.