Bis(benzonitrile)dichloroplatinum is a platinum coordination compound used as a reagent in platinum chemistry research. It features a platinum center coordinated to two benzonitrile ligands and two chloride ions, making it a valuable laboratory chemical for synthetic and catalytic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Bis(benzonitrile)dichloroplatinum 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Phenyl cyanide
solvent and intermediate for chemical synthesis
Bis(benzonitrile)palladium chloride
coordination complex and catalyst precursor
Platinate(2-), tetrachloro-, disodium, (SP-4-1)-
platinum coordination chemistry reagent
2-Propenethioamide, 3-(3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl)-2-cyano-, (E)-
Protein tyrosine kinase inhibitor
1-Bromo-4-chloro-2-iodobenzene
Research reagent for organic synthesis
1,3-Dihydro-3-(3-iodopropyl)-7,8-dimethoxy-2H-3-benzazepin-2-one
research compound
Cyclopropanecarboxaldehyde
Research reagent
bis(benzonitrile);dichloroplatinum
WAJRCRIROYMRKA-UHFFFAOYSA-L
C1=CC=C(C=C1)C#N.C1=CC=C(C=C1)C#N.Cl[Pt]Cl
Bis(benzonitrile)dichloroplatinum 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.