This compound is a sulfur-containing heterocyclic molecule with a fused thieno-thiopyran ring system. It features a chiral center and a sulfone group, contributing to its structural complexity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 148719-91-9
(6S)-6-methyl-7,7-dioxo-5,6-dihydrothieno[2,3-b]thiopyran-4-one
LQUUXMUPBQBKHA-YFKPBYRVSA-N
C[C@H]1CC(=O)C2=C(S1(=O)=O)SC=C2