Methyl 4-bromo-3-methylbenzoate is a chemical compound commonly used as a pharmaceutical intermediate. It features an aromatic ring with an ester and a halogen substituent, making it suitable for further chemical transformations in drug synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Methyl 4-bromo-3-methylbenzoate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl 3-bromo-4-methylbenzoate
Pharmaceutical intermediate
Biphenyl2,2',3,3',4,4',5,5',6,6'd10
Deuterated biphenyl for organic synthesis
4-Benzyloxybenzoic acid
Pharmaceutical intermediate for synthesis
5-Chloro-4-methyl-3-nitropyridin-2-amine
pharmaceutical intermediate
Nizatidine impurity K
Pharmaceutical intermediate for nizatidine
methyl 4-bromo-3-methylbenzoate
GTZTYNPAPQKIIR-UHFFFAOYSA-N
CC1=C(C=CC(=C1)C(=O)OC)Br
Methyl 4-bromo-3-methylbenzoate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.