This compound is a deuterated amine reference standard used in analytical and research applications. Its fully deuterated methyl groups make it valuable for mass spectrometry and nuclear magnetic resonance spectroscopy as an internal standard or tracer.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 14802-36-9
Di((2H3)methyl)ammonium chloride
deuterated analytical standard
Ethyl-d5-amine hydrochloride
deuterated amine reference standard
Dibenzocyclooctyne-PEG4 maleimide
Copper-free click chemistry reagent
2,4-Dichloro-6-phenyl-1,3,5-triazine-d5
deuterated research reagent
2-Chloro-4,4,5,5-tetramethyl-1,3,2-dioxaphospholane
Phosphorochloridite reagent
1-Benzylpiperidin-3-ol
research compound
Dimethylamine hydrochloride
Paint and industrial chemical intermediate
Dimethylamine-15N hydrochloride
isotopically labeled research reagent
1,1,1-trideuterio-N-(trideuteriomethyl)methanamine
ROSDSFDQCJNGOL-WFGJKAKNSA-N
[2H]C([2H])([2H])NC([2H])([2H])[2H]