Indole-2-carboxylic acid is an indolyl carboxylic acid used primarily as a research compound or assay reagent. Its structure features a carboxylic acid group attached to an indole ring, contributing to its utility in laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1477-50-5
Propionic-2,2-d2 acid-d
deuterated research reagent
Omega-conotoxin MVIIC
research compound
Copper(ii)hexafluor-2,4-pentanedionate
Coordination chemistry research reagent
Dichloro(1,10-phenanthroline)copper(II)
research compound
1H-indole-2-carboxylic acid
HCUARRIEZVDMPT-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=C(N2)C(=O)O