This compound is a research reagent characterized as an inhibitor of the SARS-CoV 3CL protease. Its structure features multiple amide groups, aromatic rings, and a heterocyclic system, reflecting its intended application in antiviral compound studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Amino-3-(thiazol-4-yl)propanoic acid
research compound
N2-(4-(((2-Amino-4-oxo-4,8-dihydropteridin-6-yl)methyl)amino)benzoyl)-N5-(2-(2-(2-azidoethoxy)ethoxy)ethyl)-L-glutamine
PEGylated folate probe for click chemistry
2-Chloro-4-(naphthalen-1-yl)-6-phenyl-1,3,5-triazine
Research chemical for organic synthesis
Ethyl 2-(1H-1,3-benzodiazol-2-yl)acetate
research compound
N-[(2S)-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methoxy-1H-indole-2-carboxamide
JBLLRCOZJMVOAE-HSQYWUDLSA-N
CC(C)C[C@@H](C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C2=NC3=CC=CC=C3S2)NC(=O)C4=CC5=C(N4)C=CC=C5OC
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.