N-(1-Naphthyl)ethylenediamine dihydrochloride is a chemical reagent that appears as a white to light tan or gray crystalline solid or off-white powder. It is primarily used for the determination of sulfanilamide in body fluids.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1465-25-4
N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride
MZNYWPRCVDMOJG-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=CC=C2NCCN.Cl.Cl