DIDNTB is a highly brominated and iodinated phenolic compound used as a biochemical research reagent. Its structure features multiple halogen substituents and nitro groups, making it a specialized tool for laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 145551-16-2
(prop-1-en-2-yl)boronic acid
boronic acid reagent for synthesis
Ruthenium, dicarbonyldichlorobis(triphenylphosphine)-
catalyst for organic synthesis
1,1-Dimethylethyl N-[(3S,5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)-3-piperidinyl]carbamate
Research reagent
Tert-Butyl ((3S,5S,6R)-6-methyl-2-oxo-5-(2,3,6-trifluorophenyl)piperidin-3-yl)carbamate
Research compound
Tetrabromophenol blue
pH indicator and dye
Bromothymol blue
pH indicator
Bromocresol green
pH indicator dye
Bromocresol purple
pH indicator dye
2-iodo-6-nitro-4-[4,5,6,7-tetrabromo-3-(4-hydroxy-3-iodo-5-nitrophenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]phenol
NMHYCKTXIQQVPE-UHFFFAOYSA-N
C1=C(C=C(C(=C1[N+](=O)[O-])O)I)C2(C3=C(C(=C(C(=C3Br)Br)Br)Br)S(=O)(=O)O2)C4=CC(=C(C(=C4)I)O)[N+](=O)[O-]