1-Boc-D-Pyroglutamic acid ethyl ester is a chemical compound used as a pharmaceutical intermediate. It features a protected amino acid derivative structure with a tert-butoxycarbonyl (Boc) group and an ethyl ester, commonly employed in the synthesis of peptide-based compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 144978-35-8
1-tert-butyl 2-methyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
(S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-methoxy-4-oxobutanoic acid
Protected amino acid for peptide synthesis
T-Butyl (3S)-3-fluoro-4-oxopiperidine-1-carboxylate
pharmaceutical intermediate
((1R,2S)-2-(3-fluorophenyl)-2-((tosyloxy)methyl)cyclopropyl)methyl acetate
pharmaceutical intermediate
2-bromo-1-(4-methylphenyl)propan-1-one
pharmaceutical intermediate
1-(1,1-Dimethylethyl) 2-ethyl (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
Pharmaceutical intermediate for peptide synthesis
1-O-tert-butyl 2-O-ethyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate
YWWWGFSJHCFVOW-MRVPVSSYSA-N
CCOC(=O)[C@H]1CCC(=O)N1C(=O)OC(C)(C)C