This compound is a pharmaceutical intermediate primarily used in the manufacturing of antihypertensive agents. It features a complex multi-ring structure with aromatic and heterocyclic components, and is supplied as a research-grade chemical for laboratory and development purposes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 144690-33-5
Trityl olMesartan acid
Pharmaceutical intermediate for drug synthesis
Tritylolmesartan medoxomil
Pharmaceutical intermediate for olmesartan medoxomil
N-Trityl Olmesartan Ethyl Ester
pharmaceutical intermediate
P-(Chlorodiphenylmethyl)anisole
Pharmaceutical intermediate for oligonucleotide synthesis
Desacetyl-7-desmethyl Agomelatine Hydrobromide
Pharmaceutical intermediate for agomelatine synthesis
Methyl (2-chlorophenyl)(4,7-dihydrothieno(2,3-c)pyridin-6(5H)-yl)acetate--hydrogen chloride (1/1)
Clopidogrel impurity reference standard
N-Carbamoyl-2-cyanoacetamide
Pharmaceutical intermediate
(2-BUTYL-4-CHLORO-1-((2'-(1-TRITYL-1H-TETRAAZOL-5-YL)(1,1'-BIPHENYL)-4-YL)METHYL)-1H-IMIDAZOL-5-YL)METHANOL
pharmaceutical impurity standard
ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate
TZQDBKJBKJIHPR-UHFFFAOYSA-N
CCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NN=NN4C(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)C(=O)OCC)C(C)(C)O