14-epi-triptolide is a stereoisomer of triptolide, a diterpenoid epoxide isolated from the traditional Chinese medicinal plant Tripterygium wilfordii. It is primarily used as a research compound to investigate the structure-activity relationships and biological properties of the triptolide scaffold.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 144539-79-7
6-(tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,5-a]pyridine
Research reagent for medicinal chemistry
(S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1-trityl-1H-imidazol-4-yl)propanamido)-2-methylpropanoic acid
Research compound for peptide synthesis
N-Succinimidyl palmitate
crosslinking reagent for bioconjugation
IvDde-L-Lys(Fmoc)-OH
protected amino acid derivative
Triptolide
phytogenic antineoplastic agent
(1S,2S,4S,5S,7R,8S,9S,11S,13S)-8-hydroxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one
DFBIRQPKNDILPW-FKXGARDLSA-N
CC(C)[C@@]12[C@@H](O1)[C@H]3[C@@]4(O3)[C@]5(CCC6=C([C@@H]5C[C@H]7[C@]4([C@H]2O)O7)COC6=O)C