4-Nitrophenyl 1,3-thiazol-5-ylmethyl carbonate is a chemical compound used as a pharmaceutical intermediate. It features a carbonate ester linked to a nitrophenyl group and a thiazole ring, making it a building block for synthesizing more complex molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 144163-97-3
1,3-Thiazol-5-ylmethyl N-[(1S,2S,4S)-4-amino-1-benzyl-2-hydroxy-5-phenylpentyl]carbamate
pharmaceutical intermediate for protease inhibitors
(S)-tert-butyl 6-(5-(7-broMo-9,9-difluoro-9H-fluoren-2-yl)-1H-iMidazol-2-yl)-5-azaspiro[2.4]heptane-5-carboxylate
Pharmaceutical intermediate for antiviral synthesis
Potassium (S)-5-(tert-butoxycarbonyl)-5-azaspiro[2.4]heptane-6-carboxylate
pharmaceutical intermediate
1-Boc-4-(aminomethyl)piperidine
Pharmaceutical intermediate for drug synthesis
(4-nitrophenyl) 1,3-thiazol-5-ylmethyl carbonate
FTEKBGGQRNJIPQ-UHFFFAOYSA-N
C1=CC(=CC=C1[N+](=O)[O-])OC(=O)OCC2=CN=CS2
—