2-Propanone, 1-(triphenylphosphoranylidene)- is a research reagent primarily used as a Wittig reagent in organic synthesis. This compound facilitates the formation of carbon-carbon double bonds, making it valuable for constructing complex organic molecules in laboratory and manufacturing research settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Propanone, 1-(triphenylphosphoranylidene)- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-Cyclopropyl-2-(triphenylphosphoranylidene)-ethanone
Wittig reagent for organic synthesis
Phosphonium, (methoxymethyl)triphenyl-, chloride
Wittig reagent for organic synthesis
(2S)-2,6-diamino-N,N-diethylhexanamide
analytical reference standard
3-(Hydroxymethyl)pyrrolidin-3-ol hydrochloride
Research compound
4-Methylpyridine hydrochloride
research compound
2,4-Difluorophenylboronic acid
chemical intermediate for synthesis
Methyl (triphenylphosphoranylidene)acetate
Wittig reagent for organic synthesis
Tert-butyl (triphenylphosphoranylidene) acetate
phosphine reagent for Wittig reaction
1-(triphenyl-lambda5-phosphanylidene)propan-2-one
KAANTNXREIRLCT-UHFFFAOYSA-N
CC(=O)C=P(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
2-Propanone, 1-(triphenylphosphoranylidene)- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.