Copper(II) ethylacetoacetate is a copper coordination compound primarily used as a research reagent. It serves as a source of copper ions in synthetic and materials chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 14284-06-1
Rhodium(III) 2,4-pentanedionate
Research reagent and reference standard
Ruthenium(III) acetylacetonate
coordination chemistry research reagent
((5Alpha,6Alpha)-4,5-Epoxymorphinan-3,6-diol)
Certified reference standard
N4-Acetylcytidine triphosphate
Modified nucleotide triphosphate for research
copper bis(ethyl 3-oxobutanoate)
OXFZSJOUPRCPJO-UHFFFAOYSA-N
CCOC(=O)[CH-]C(=O)C.CCOC(=O)[CH-]C(=O)C.[Cu+2]