2-Trifluoromethylphenylboronic acid is an organoboron compound featuring a boronic acid group and a trifluoromethyl substituent on the aromatic ring. It is primarily used as a research reagent in organic synthesis, particularly for building carbon-carbon bonds in cross-coupling reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Trifluoromethylphenylboronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Ethynylaniline
Research intermediate for supramolecular chemistry
4-Bromo-1,1'-biphenyl-d9
research reagent
4-bromopyridin-1-ium-1-olate
research compound
Fmoc-Thr(Tbu)-Ser(Psi(Me,Me)Pro)-OH
Building block for peptide synthesis
[2-(trifluoromethyl)phenyl]boronic acid
JNSBEPKGFVENFS-UHFFFAOYSA-N
B(C1=CC=CC=C1C(F)(F)F)(O)O
2-Trifluoromethylphenylboronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.