This compound is a benzofuran derivative featuring a nitro group and a hydroxyphenyl ketone moiety. It is primarily used as a pharmaceutical intermediate in the synthesis of other chemical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 141645-16-1
(2-Butyl-5-nitrobenzofuran-3-yl)(4-methoxyphenyl)methanone
research compound
(5-Bromo-3-(trifluoromethyl)pyridin-2-yl)methanamine hydrochloride
pharmaceutical synthetic intermediate
3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile
DNA synthesis phosphoramidite building block
Tert-butyl 3-hydroxyazetidine-1-carboxylate
protected building block for synthesis
Tert-Butyl 3-((methylsulfonyl)oxy)pyrrolidine-1-carboxylate
Pharmaceutical intermediate
(2-Butyl-5-nitrobenzofuran-3-yl)(4-(3-dibutylaminopropoxy)phenyl)methanone
active pharmaceutical ingredient
(2-Butylbenzofuran-3-yl) (4-hydroxyphenyl) ketone
pharmaceutical intermediate
1-Methoxy Amiodarone
pharmaceutical impurity reference standard
(2-butyl-5-nitro-1-benzofuran-3-yl)-(4-hydroxyphenyl)methanone
ZJZKLBXEGZKOBW-UHFFFAOYSA-N
CCCCC1=C(C2=C(O1)C=CC(=C2)[N+](=O)[O-])C(=O)C3=CC=C(C=C3)O