Mal-PEG4-PFP ester is a heterobifunctional crosslinking reagent featuring a maleimide group and a pentafluorophenyl ester linked by a hydrophilic polyethylene glycol (PEG) spacer. It is primarily used in bioconjugation chemistry for the modification of biomolecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Mal-PEG4-PFP ester 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Mal-PEG2-PFP ester
heterobifunctional crosslinking reagent
T-Boc-N-amido-PEG12-acid
PEG-based linker for bioconjugation
4,6-DICHLORO-2-METHYLPYRIMIDINE-5-CARBALDEHYDE
research compound
Ethyl (2S,5R)-5-((benzyloxy)amino)piperidine-2-carboxylate
Research compound
(2-Butyl-5-nitrobenzofuran-3-yl)(4-methoxyphenyl)methanone
research compound
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate
XGSVXFAIAZKWST-UHFFFAOYSA-N
C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F
Mal-PEG4-PFP ester 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.