This compound is a deuterated analytical reference standard, specifically the nitric acid salt of a deuterated imidazole derivative. It is primarily used as a research reagent for analytical chemistry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(+/-)-Miconazole-d5 Nitrate (2,4-Dichlorobenzyloxy-d5) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Imazalil-d5 Sulfate
deuterated analytical reference standard
Bis(2-butoxyethyl) Phthalate-d4
reference standard for phthalate analysis
2,4-DICHLOROBENZOIC-D3 ACID
deuterated research reference standard
(+/-)-Zopiclone-d3 (N-methyl-d3)
deuterated research standard
Miconazole nitrate
antifungal active pharmaceutical ingredient
미코나졸
antifungal active pharmaceutical ingredient
Miconazole nitrate
antifungal active pharmaceutical ingredient
Econazole nitrate
active pharmaceutical ingredient
1-[2-(2,4-dichlorophenyl)-2-[dideuterio-(2,4-dichloro-3,5,6-trideuteriophenyl)methoxy]ethyl]imidazole;nitric acid
MCCACAIVAXEFAL-LVRIMRNISA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])OC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)Cl)[2H])Cl)[2H].[N+](=O)(O)[O-]
(+/-)-Miconazole-d5 Nitrate (2,4-Dichlorobenzyloxy-d5) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.