4-(Trifluoromethoxy)phenylboronic acid is a boronic acid derivative frequently employed as a research compound in organic synthesis. Its structure features an aromatic ring with a trifluoromethoxy substituent, contributing to its reactivity and utility in building complex molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 139301-27-2
4-Nitrophenylboronic acid
research compound for organic synthesis
2,3,4,5-Tetrafluorobenzoic acid
research compound for organic synthesis
4-(Trifluoromethyl)phenylboronic acid
research compound for organic synthesis
3-FORMYL-4-(TRIFLUOROMETHOXY)PHENYBORONIC ACID
research compound for organic synthesis
Tetraamminepalladium(II) chloride monohydrate
research compound for palladium chemistry
Azido-PEG2-PFP ester
bioconjugation crosslinking reagent
4,7,10,13,16-Pentaoxanonadec-18-ynoic acid, 2,5-dioxo-1-pyrrolidinyl ester
PEG-linked alkyne NHS ester crosslinker
(5-Chloro-3-(trifluoromethyl)pyridin-2-yl)methanamine
research reagent
[4-(trifluoromethoxy)phenyl]boronic acid
HUOFUOCSQCYFPW-UHFFFAOYSA-N
B(C1=CC=C(C=C1)OC(F)(F)F)(O)O
—