Rifamycin B is an antibiotic compound belonging to the rifamycin group, which is synthesized by the bacterium Amycolatopsis rifamycinica. It is primarily used as an active pharmaceutical ingredient in the manufacture of antibiotics effective against mycobacteria.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
RIFAMYCIN B 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
RIFAMYCIN SODIUM
sodium salt antibiotic active ingredient
Selinexor
active pharmaceutical ingredient
Narmafotinib
FAK1 inhibitor active pharmaceutical ingredient
Macitentan metabolite M4
Active pharmaceutical ingredient metabolite
Tiotropium bromide hydrate
bronchodilator agent
2-[[(7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-13-acetyloxy-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-27-yl]oxy]acetic acid
SQTCRTQCPJICLD-KTQDUKAHSA-N
C[C@H]1/C=C/C=C(\C(=O)NC2=CC(=C3C(=C2O)C(=C(C4=C3C(=O)[C@](O4)(O/C=C/[C@@H]([C@H]([C@H]([C@@H]([C@@H]([C@@H]([C@H]1O)C)O)C)OC(=O)C)C)OC)C)C)O)OCC(=O)O)/C
RIFAMYCIN B 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.