This compound is a research reagent, a methyl benzoate derivative with an imidazole ring and a stereocenter. It is primarily used as a laboratory chemical for scientific investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1391712-57-4
1-Naphthaleneboronic acid
Boronic acid research compound
(+/-)-Ropivacaine-d7 (propyl-d7)
deuterated analytical standard
1-Ethyl-5-iodopyrazole
Research compound
Internalized-arginylglycylaspartic acid cyclic peptide
research compound
methyl 2-methoxy-5-[[[(1S)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]amino]methyl]benzoate
YYKCFFFHGRUDFT-AWEZNQCLSA-N
C[C@@H](C1=NC=C(N1)C2=CC=CC=C2)NCC3=CC(=C(C=C3)OC)C(=O)OC
—