CL 316,243 is a research compound that acts on the beta-3 adrenergic receptor. It is a salt-form molecule containing multiple polar and aromatic functional groups, typically used in laboratory studies to investigate receptor pharmacology.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 138908-40-4
Dirhodium tetracaprolactamate
dirhodium catalyst for carbene reactions
(3R)-(+)-3-(Methylamino)pyrrolidine
research compound
4-Fluoro-3-(trifluoromethyl)phenyl isocyanate
chemical synthesis intermediate
N,N-Bis(2-(6-fluorochroman-2-yl)-2-hydroxyethyl)nitrous amide
Nitrosamine reference standard
disodium;5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate
FUZBPOHHSBDTJQ-CFOQQKEYSA-L
C[C@H](CC1=CC2=C(C=C1)OC(O2)(C(=O)[O-])C(=O)[O-])NC[C@@H](C3=CC(=CC=C3)Cl)O.[Na+].[Na+]