(3-Phenoxyphenyl)methanol is a chemical compound primarily known as a metabolite formed during the hydrolysis of certain pyrethroid insecticides, such as permethrin, by enzymes like pyrethroid hydrolase. It features an alcohol group, two aromatic rings, and an ether linkage, contributing to its moderate lipophilicity and polar surface area.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(3-Phenoxyphenyl)methanol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Phenoxybenzoic acid
pyrethroid insecticide metabolite
Imidacloprid
systemic insecticide for crop protection
1-[(difluoromethyl)sulfonyl]-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-7-fluoro-1H-indol-2-ol
Agrochemical intermediate or active ingredient
2,4-DICHLOROTOLUENE-3,5,6-D3
Deuterated agrochemical reference standard
Quizalofop-ethyl D3 (3,3,3-D3)
Herbicide active ingredient
(3-Phenoxyphenyl)methanol(CAS 13826-35-2)의 국제 HS 코드는 2909.49입니다.
2909.49
2909 49 80
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(3-phenoxyphenyl)methanol
KGANAERDZBAECK-UHFFFAOYSA-N
C1=CC=C(C=C1)OC2=CC=CC(=C2)CO
(3-Phenoxyphenyl)methanol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.