(3-Phenoxyphenyl)methanol is a chemical compound primarily known as a metabolite formed during the hydrolysis of certain pyrethroid insecticides, such as permethrin, by enzymes like pyrethroid hydrolase. It features an alcohol group, two aromatic rings, and an ether linkage, contributing to its moderate lipophilicity and polar surface area.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13826-35-2
3-Phenoxybenzoic acid
pyrethroid insecticide metabolite
Imidacloprid
systemic insecticide for crop protection
1-[(difluoromethyl)sulfonyl]-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-7-fluoro-1H-indol-2-ol
Agrochemical intermediate or active ingredient
2,4-DICHLOROTOLUENE-3,5,6-D3
Deuterated agrochemical reference standard
Quizalofop-ethyl D3 (3,3,3-D3)
Herbicide active ingredient
(3-phenoxyphenyl)methanol
KGANAERDZBAECK-UHFFFAOYSA-N
C1=CC=C(C=C1)OC2=CC=CC(=C2)CO