Carzenide is a chemical compound that occurs as a byproduct in the manufacture of saccharin. It is used as a pharmaceutical intermediate and is structurally characterized by the presence of a sulfonamide group and a carboxylic acid function on an aromatic ring.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 138-41-0
Shikimic acid
pharmaceutical intermediate and plant metabolite
Tert-butyl Piperidine-4-carboxylate
pharmaceutical intermediate
Piperidin-3-amine dihydrochloride
pharmaceutical intermediate
Formamide, N-(2-(7-methoxy-1-naphthalenyl)ethyl)-
pharmaceutical intermediate for agomelatine synthesis
4-sulfamoylbenzoic acid
UCAGLBKTLXCODC-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)O)S(=O)(=O)N