6-Ethenylnaphthalen-2-ol is a chemical compound used as a pharmaceutical intermediate. It features a naphthalene ring system with an ethenyl and a hydroxyl substituent, and is typically supplied for research and manufacturing purposes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
6-Ethenylnaphthalen-2-ol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
((1S, 2R)-1-(3-Fluorophenyl) Cyclopropane-1,2-diyl) Dimethanol
pharmaceutical intermediate
((1R, 2S)-2-(3-Fluorophenyl)-2-(Hydroxymethyl)Cyclopropyl) Methyl Acetate
pharmaceutical intermediate
2-[(2S)-2-Hydroxy-3-[[4-(3-oxo-4-morpholinyl)phenyl]amino]propyl]-1H-isoindole-1,3(2H)-dione
pharmaceutical intermediate
4-(Dibenzo[b,d]thiophen-4-yl)aniline
pharmaceutical intermediate
6-ethenylnaphthalen-2-ol
XVZWMPLMWUJTCE-UHFFFAOYSA-N
C=CC1=CC2=C(C=C1)C=C(C=C2)O
6-Ethenylnaphthalen-2-ol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.