4-Pyridinecarboxylic acid 1-oxide is an N-oxide derivative of isonicotinic acid, featuring a carboxylic acid group attached to a pyridine ring at the 4-position. It is structurally related to picolinic acid and nicotinic acid, which have the carboxyl group at the 2- and 3-positions, respectively.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13602-12-5
Triphenylmethylium tetrakis(perfluorophenyl)borate
Research reagent for hydride abstraction
3'-O-(Azidomethyl)-2'-deoxythymidine
Research compound
5-bromo-3-(trifluoromethyl)pyrazin-2-amine
research compound
4-BROMO-1-BUTANOL-1,1,2,2,3,3,4,4-D8
deuterated research compound
1-oxidopyridin-1-ium-4-carboxylic acid
QCWTWMJMLSKQCJ-UHFFFAOYSA-N
C1=C[N+](=CC=C1C(=O)O)[O-]