Dipropyl pyridine-2,5-dicarboxylate is an agrochemical compound used primarily as an insect repellent. Its structure features a pyridine ring with two ester functional groups, contributing to its chemical properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 136-45-8
Dimethyl carbate
insect repellent
Urea, N-[2,6-bis(1-methylethyl)-4-phenoxyphenyl]-N'-(1,1-dimethylethyl)-
urea herbicide intermediate
3,5-dichloro-2,4,6-trifluorobenzoic acid
agrochemical intermediate
Thiram
Crop fungicide and seed protectant
ZIRAM
fungicide for vegetable diseases
dipropyl pyridine-2,5-dicarboxylate
IITCWRFYJWUUPC-UHFFFAOYSA-N
CCCOC(=O)C1=CN=C(C=C1)C(=O)OCCC