Ald-PEG4-NHS ester is a heterobifunctional crosslinking reagent used for bioconjugation. Its structure features an aldehyde group and an N-hydroxysuccinimide (NHS) ester linked by a hydrophilic polyethylene glycol (PEG) spacer, enabling site-specific conjugation of biomolecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1353011-74-1
Azido-PEG2-PFP ester
bioconjugation crosslinking reagent
Perfluorophenyl 3-(pyridin-2-yldisulfanyl)propanoate
bioconjugation crosslinking reagent
Azido-PEG8-NHS ester
bioconjugation crosslinking reagent
Azido-PEG4-PFP ester
bioconjugation and PEGylation reagent
11,12-Didehydro-gamma-oxodibenz[b,f]azocine-5(6H)-butanoic acid
click chemistry reagent
Dbco-nhs ester
Copper-free click chemistry reagent
2-Bromo-3-fluoro-5-nitropyridine
Research compound for organic synthesis
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate
QUFDNMPGNAZKHD-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)C2=CC=C(C=C2)C=O