This compound is a protected amino acid intermediate used in peptide synthesis. It features a benzyloxycarbonyl (Cbz) protecting group on the nitrogen of 4-hydroxy-L-proline, making it a key building block for the production of modified peptides and pharmaceutical intermediates.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Dibenzyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate
protected proline derivative for peptide synthesis
N-Cbz-cis-4-Hydroxy-L-proline methyl ester
protected proline derivative for peptide synthesis
2-Methyl 1-(phenylmethyl) (2S,4R)-4-hydroxy-1,2-pyrrolidinedicarboxylate
Peptide synthesis building block
Boc-O-methyl-L-tyrosine
Protected amino acid intermediate
(2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoic acid
Protected amino acid intermediate
2-{[(tert-butoxy)carbonyl]amino}-2-(3-chlorophenyl)acetic acid
Protected amino acid intermediate
N-(tert-Butoxycarbonyl)-L-cyclohexylglycine
Protected amino acid intermediate
N-Boc-cis-4-Hydroxy-D-proline
Pharmaceutical intermediate for peptide synthesis
1-(Phenylmethyl) (2S,4R)-4-hydroxy-1,2-pyrrolidinedicarboxylate(CAS 13504-85-3)의 국제 HS 코드는 2933.99입니다.
2933.99
2933 99 80
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(2S,4R)-4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid
WWVCWLBEARZMAH-MNOVXSKESA-N
C1[C@H](CN([C@@H]1C(=O)O)C(=O)OCC2=CC=CC=C2)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.