This compound is a protected amino acid intermediate used in peptide synthesis. It features a benzyloxycarbonyl (Cbz) protecting group on the nitrogen of 4-hydroxy-L-proline, making it a key building block for the production of modified peptides and pharmaceutical intermediates.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13504-85-3
Dibenzyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate
protected proline derivative for peptide synthesis
N-Cbz-cis-4-Hydroxy-L-proline methyl ester
protected proline derivative for peptide synthesis
2-Methyl 1-(phenylmethyl) (2S,4R)-4-hydroxy-1,2-pyrrolidinedicarboxylate
Peptide synthesis building block
Boc-O-methyl-L-tyrosine
Protected amino acid intermediate
(2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoic acid
Protected amino acid intermediate
2-{[(tert-butoxy)carbonyl]amino}-2-(3-chlorophenyl)acetic acid
Protected amino acid intermediate
N-(tert-Butoxycarbonyl)-L-cyclohexylglycine
Protected amino acid intermediate
N-Boc-cis-4-Hydroxy-D-proline
Pharmaceutical intermediate for peptide synthesis
(2S,4R)-4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid
WWVCWLBEARZMAH-MNOVXSKESA-N
C1[C@H](CN([C@@H]1C(=O)O)C(=O)OCC2=CC=CC=C2)O